C11H15N3O4 — CID 123259789
4-N-(3-aminopropyl)-2,3-dihydroxybenzene-1,4-dicarboxamide (PubChem CID 123259789) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-2,3-dihydroxybenzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-aminopropyl)-2,3-dihydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 123259789 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-N-(3-aminopropyl)-2,3-dihydroxybenzene-1,4-dicarboxamide |
| SMILES | NCCCNC(=O)c1ccc(C(N)=O)c(O)c1O |
| InChI | InChI=1S/C11H15N3O4/c12-4-1-5-14-11(18)7-3-2-6(10(13)17)8(15)9(7)16/h2-3,15-16H,1,4-5,12H2,(H2,13,17)(H,14,18) |
| InChIKey | XMCGQLCOJZZLEA-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|