C20H25FN2O — CID 143176250
N-[4-(cyclohepten-1-yl)butyl]-5-fluoro-1H-indole-2-carboxamide (PubChem CID 143176250) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is N-[4-(cyclohepten-1-yl)butyl]-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(cyclohepten-1-yl)butyl]-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143176250 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-[4-(cyclohepten-1-yl)butyl]-5-fluoro-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCCC1=CCCCCC1)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C20H25FN2O/c21-17-10-11-18-16(13-17)14-19(23-18)20(24)22-12-6-5-9-15-7-3-1-2-4-8-15/h7,10-11,13-14,23H,1-6,8-9,12H2,(H,22,24) |
| InChIKey | LEVGHESEIJXKBA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|