C26H28FN5O — CID 135324430
1-benzyl-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)benzimidazole-2-carboxamide (PubChem CID 135324430) has the molecular formula C26H28FN5O and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-benzyl-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)benzimidazole-2-carboxamide.
| Compound Name | 1-benzyl-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 135324430 |
| Molecular Formula | C26H28FN5O |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-benzyl-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)benzimidazole-2-carboxamide |
| SMILES | NCCCC(N)CNC(=O)c1nc2ccc(-c3ccc(F)cc3)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C26H28FN5O/c27-21-11-8-19(9-12-21)20-10-13-23-24(15-20)32(17-18-5-2-1-3-6-18)25(31-23)26(33)30-16-22(29)7-4-14-28/h1-3,5-6,8-13,15,22H,4,7,14,16-17,28-29H2,(H,30,33) |
| InChIKey | ZEGDHVHZWRXTKX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |