C27H31N5O2 — CID 135324766
1-benzyl-N-(2,5-diaminopentyl)-6-(4-methoxyphenyl)benzimidazole-2-carboxamide (PubChem CID 135324766) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-benzyl-N-(2,5-diaminopentyl)-6-(4-methoxyphenyl)benzimidazole-2-carboxamide.
| Compound Name | 1-benzyl-N-(2,5-diaminopentyl)-6-(4-methoxyphenyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 135324766 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 1-benzyl-N-(2,5-diaminopentyl)-6-(4-methoxyphenyl)benzimidazole-2-carboxamide |
| SMILES | COc1ccc(-c2ccc3nc(C(=O)NCC(N)CCCN)n(Cc4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-34-23-12-9-20(10-13-23)21-11-14-24-25(16-21)32(18-19-6-3-2-4-7-19)26(31-24)27(33)30-17-22(29)8-5-15-28/h2-4,6-7,9-14,16,22H,5,8,15,17-18,28-29H2,1H3,(H,30,33) |
| InChIKey | LRBVNHSTTSTEQV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |