C25H23Cl2N3O2 — CID 139771554
1-benzyl-6-chloro-N-[[3-(3-chloropropoxy)phenyl]methyl]benzimidazole-2-carboxamide (PubChem CID 139771554) has the molecular formula C25H23Cl2N3O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is 1-benzyl-6-chloro-N-[[3-(3-chloropropoxy)phenyl]methyl]benzimidazole-2-carboxamide.
| Compound Name | 1-benzyl-6-chloro-N-[[3-(3-chloropropoxy)phenyl]methyl]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 139771554 |
| Molecular Formula | C25H23Cl2N3O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 1-benzyl-6-chloro-N-[[3-(3-chloropropoxy)phenyl]methyl]benzimidazole-2-carboxamide |
| SMILES | O=C(NCc1cccc(OCCCCl)c1)c1nc2ccc(Cl)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C25H23Cl2N3O2/c26-12-5-13-32-21-9-4-8-19(14-21)16-28-25(31)24-29-22-11-10-20(27)15-23(22)30(24)17-18-6-2-1-3-7-18/h1-4,6-11,14-15H,5,12-13,16-17H2,(H,28,31) |
| InChIKey | SSHYAIYVJFLVMS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|