C26H26ClN3O3 — CID 139771555
1-benzyl-6-chloro-N-[[2-(4-hydroxybutoxy)phenyl]methyl]benzimidazole-2-carboxamide (PubChem CID 139771555) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 1-benzyl-6-chloro-N-[[2-(4-hydroxybutoxy)phenyl]methyl]benzimidazole-2-carboxamide.
| Compound Name | 1-benzyl-6-chloro-N-[[2-(4-hydroxybutoxy)phenyl]methyl]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 139771555 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-benzyl-6-chloro-N-[[2-(4-hydroxybutoxy)phenyl]methyl]benzimidazole-2-carboxamide |
| SMILES | O=C(NCc1ccccc1OCCCCO)c1nc2ccc(Cl)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C26H26ClN3O3/c27-21-12-13-22-23(16-21)30(18-19-8-2-1-3-9-19)25(29-22)26(32)28-17-20-10-4-5-11-24(20)33-15-7-6-14-31/h1-5,8-13,16,31H,6-7,14-15,17-18H2,(H,28,32) |
| InChIKey | VXPUIMSHLZMZFI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|