C26H24BrClN4O2 — CID 139771552
1-benzyl-N-[[3-(4-bromobutanoylamino)phenyl]methyl]-6-chlorobenzimidazole-2-carboxamide (PubChem CID 139771552) has the molecular formula C26H24BrClN4O2 and a molecular weight of 539.86 g/mol. Its IUPAC name is 1-benzyl-N-[[3-(4-bromobutanoylamino)phenyl]methyl]-6-chlorobenzimidazole-2-carboxamide.
| Compound Name | 1-benzyl-N-[[3-(4-bromobutanoylamino)phenyl]methyl]-6-chlorobenzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 139771552 |
| Molecular Formula | C26H24BrClN4O2 |
| Molecular Weight | 539.86 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 1-benzyl-N-[[3-(4-bromobutanoylamino)phenyl]methyl]-6-chlorobenzimidazole-2-carboxamide |
| SMILES | O=C(CCCBr)Nc1cccc(CNC(=O)c2nc3ccc(Cl)cc3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C26H24BrClN4O2/c27-13-5-10-24(33)30-21-9-4-8-19(14-21)16-29-26(34)25-31-22-12-11-20(28)15-23(22)32(25)17-18-6-2-1-3-7-18/h1-4,6-9,11-12,14-15H,5,10,13,16-17H2,(H,29,34)(H,30,33) |
| InChIKey | JTQLXINAIQCZOE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.86 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|