C29H31N5O6 — CID 135324857
[(2S)-1-[[1-benzyl-6-(4-methoxyphenyl)benzimidazole-2-carbonyl]amino]-5-(carboxyamino)pentan-2-yl]carbamic acid (PubChem CID 135324857) has the molecular formula C29H31N5O6 and a molecular weight of 545.60 g/mol. Its IUPAC name is [(2S)-1-[[1-benzyl-6-(4-methoxyphenyl)benzimidazole-2-carbonyl]amino]-5-(carboxyamino)pentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[1-benzyl-6-(4-methoxyphenyl)benzimidazole-2-carbonyl]amino]-5-(carboxyamino)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135324857 |
| Molecular Formula | C29H31N5O6 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | [(2S)-1-[[1-benzyl-6-(4-methoxyphenyl)benzimidazole-2-carbonyl]amino]-5-(carboxyamino)pentan-2-yl]carbamic acid |
| SMILES | COc1ccc(-c2ccc3nc(C(=O)NC[C@H](CCCNC(=O)O)NC(=O)O)n(Cc4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C29H31N5O6/c1-40-23-12-9-20(10-13-23)21-11-14-24-25(16-21)34(18-19-6-3-2-4-7-19)26(33-24)27(35)31-17-22(32-29(38)39)8-5-15-30-28(36)37/h2-4,6-7,9-14,16,22,30,32H,5,8,15,17-18H2,1H3,(H,31,35)(H,36,37)(H,38,39)/t22-/m0/s1 |
| InChIKey | VIAQGYIIADSXPM-QFIPXVFZSA-N |
| XLogP | 4.17 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|