C26H26F2N4O — CID 142426166
N-(5-aminopentyl)-1-benzyl-5-(3,4-difluorophenyl)benzimidazole-2-carboxamide (PubChem CID 142426166) has the molecular formula C26H26F2N4O and a molecular weight of 448.52 g/mol. Its IUPAC name is N-(5-aminopentyl)-1-benzyl-5-(3,4-difluorophenyl)benzimidazole-2-carboxamide.
| Compound Name | N-(5-aminopentyl)-1-benzyl-5-(3,4-difluorophenyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 142426166 |
| Molecular Formula | C26H26F2N4O |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-(5-aminopentyl)-1-benzyl-5-(3,4-difluorophenyl)benzimidazole-2-carboxamide |
| SMILES | NCCCCCNC(=O)c1nc2cc(-c3ccc(F)c(F)c3)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C26H26F2N4O/c27-21-11-9-19(15-22(21)28)20-10-12-24-23(16-20)31-25(26(33)30-14-6-2-5-13-29)32(24)17-18-7-3-1-4-8-18/h1,3-4,7-12,15-16H,2,5-6,13-14,17,29H2,(H,30,33) |
| InChIKey | FZNQTLQZSLZWQV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|