C20H21BrN4O2 — CID 165388817
N-(4-aminobutyl)-3-[(4-bromophenyl)methyl]-4-oxoquinazoline-2-carboxamide (PubChem CID 165388817) has the molecular formula C20H21BrN4O2 and a molecular weight of 429.32 g/mol. Its IUPAC name is N-(4-aminobutyl)-3-[(4-bromophenyl)methyl]-4-oxoquinazoline-2-carboxamide.
| Compound Name | N-(4-aminobutyl)-3-[(4-bromophenyl)methyl]-4-oxoquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 165388817 |
| Molecular Formula | C20H21BrN4O2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-(4-aminobutyl)-3-[(4-bromophenyl)methyl]-4-oxoquinazoline-2-carboxamide |
| SMILES | NCCCCNC(=O)c1nc2ccccc2c(=O)n1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H21BrN4O2/c21-15-9-7-14(8-10-15)13-25-18(19(26)23-12-4-3-11-22)24-17-6-2-1-5-16(17)20(25)27/h1-2,5-10H,3-4,11-13,22H2,(H,23,26) |
| InChIKey | KJTGWSVHHVOTNV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|