C29H36N4O3S — CID 22589675
4-[[2-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]methyl]-N-pentylbenzamide (PubChem CID 22589675) has the molecular formula C29H36N4O3S and a molecular weight of 520.70 g/mol. Its IUPAC name is 4-[[2-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]methyl]-N-pentylbenzamide.
| Compound Name | 4-[[2-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]methyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 22589675 |
| Molecular Formula | C29H36N4O3S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 4-[[2-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]methyl]-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(Cn2c(SCC(=O)NC3CCCCC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H36N4O3S/c1-2-3-9-18-30-27(35)22-16-14-21(15-17-22)19-33-28(36)24-12-7-8-13-25(24)32-29(33)37-20-26(34)31-23-10-5-4-6-11-23/h7-8,12-17,23H,2-6,9-11,18-20H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | QBHLVWPTEVZXEF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|