C29H36N4O4S — CID 98360147
N-cyclohexyl-4-[[2-[(2S)-1-(2-methoxyethylamino)-1-oxobutan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]methyl]benzamide (PubChem CID 98360147) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-[(2S)-1-(2-methoxyethylamino)-1-oxobutan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]methyl]benzamide.
| Compound Name | N-cyclohexyl-4-[[2-[(2S)-1-(2-methoxyethylamino)-1-oxobutan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 98360147 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | N-cyclohexyl-4-[[2-[(2S)-1-(2-methoxyethylamino)-1-oxobutan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]methyl]benzamide |
| SMILES | CC[C@H](Sc1nc2ccccc2c(=O)n1Cc1ccc(C(=O)NC2CCCCC2)cc1)C(=O)NCCOC |
| InChI | InChI=1S/C29H36N4O4S/c1-3-25(27(35)30-17-18-37-2)38-29-32-24-12-8-7-11-23(24)28(36)33(29)19-20-13-15-21(16-14-20)26(34)31-22-9-5-4-6-10-22/h7-8,11-16,22,25H,3-6,9-10,17-19H2,1-2H3,(H,30,35)(H,31,34)/t25-/m0/s1 |
| InChIKey | KQXFLIIEWUYEQI-VWLOTQADSA-N |
| XLogP | 4.14 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|