C27H29FN6O3 — CID 158578557
N-[(2S)-2,5-diaminopentyl]-1-[(2-fluoro-5-nitrophenyl)methyl]-5-(4-methylphenyl)benzimidazole-2-carboxamide (PubChem CID 158578557) has the molecular formula C27H29FN6O3 and a molecular weight of 504.57 g/mol. Its IUPAC name is N-[(2S)-2,5-diaminopentyl]-1-[(2-fluoro-5-nitrophenyl)methyl]-5-(4-methylphenyl)benzimidazole-2-carboxamide.
| Compound Name | N-[(2S)-2,5-diaminopentyl]-1-[(2-fluoro-5-nitrophenyl)methyl]-5-(4-methylphenyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 158578557 |
| Molecular Formula | C27H29FN6O3 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N-[(2S)-2,5-diaminopentyl]-1-[(2-fluoro-5-nitrophenyl)methyl]-5-(4-methylphenyl)benzimidazole-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc3c(c2)nc(C(=O)NC[C@@H](N)CCCN)n3Cc2cc([N+](=O)[O-])ccc2F)cc1 |
| InChI | InChI=1S/C27H29FN6O3/c1-17-4-6-18(7-5-17)19-8-11-25-24(14-19)32-26(27(35)31-15-21(30)3-2-12-29)33(25)16-20-13-22(34(36)37)9-10-23(20)28/h4-11,13-14,21H,2-3,12,15-16,29-30H2,1H3,(H,31,35)/t21-/m0/s1 |
| InChIKey | CGRQHNRIJQLNQT-NRFANRHFSA-N |
| XLogP | 3.90 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|