C20H24FN7O — CID 142426079
N-[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]-6-(4-fluorophenyl)-1H-benzimidazole-2-carboxamide (PubChem CID 142426079) has the molecular formula C20H24FN7O and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]-6-(4-fluorophenyl)-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]-6-(4-fluorophenyl)-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 142426079 |
| Molecular Formula | C20H24FN7O |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]-6-(4-fluorophenyl)-1H-benzimidazole-2-carboxamide |
| SMILES | NC(N)=NCCC[C@H](N)CNC(=O)c1nc2ccc(-c3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C20H24FN7O/c21-14-6-3-12(4-7-14)13-5-8-16-17(10-13)28-18(27-16)19(29)26-11-15(22)2-1-9-25-20(23)24/h3-8,10,15H,1-2,9,11,22H2,(H,26,29)(H,27,28)(H4,23,24,25)/t15-/m0/s1 |
| InChIKey | IJPYCXCOXLGADB-HNNXBMFYSA-N |
| XLogP | 1.48 |
| TPSA | 148.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|