C16H14F6O7 — CID 139684661
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,4-dioxan-2-yloxy)propanedioic acid (PubChem CID 139684661) has the molecular formula C16H14F6O7 and a molecular weight of 432.27 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,4-dioxan-2-yloxy)propanedioic acid.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,4-dioxan-2-yloxy)propanedioic acid |
|---|---|
| PubChem CID | 139684661 |
| Molecular Formula | C16H14F6O7 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,4-dioxan-2-yloxy)propanedioic acid |
| SMILES | O=C(O)C(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(OC1COCCO1)C(=O)O |
| InChI | InChI=1S/C16H14F6O7/c17-15(18,19)9-3-8(4-10(5-9)16(20,21)22)6-14(12(23)24,13(25)26)29-11-7-27-1-2-28-11/h3-5,11H,1-2,6-7H2,(H,23,24)(H,25,26) |
| InChIKey | QXFFPMBGBKDFKQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|