C11H12F4O — CID 91657147
1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpropan-2-ol (PubChem CID 91657147) has the molecular formula C11H12F4O and a molecular weight of 236.21 g/mol. Its IUPAC name is 1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpropan-2-ol.
| Compound Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 91657147 |
| Molecular Formula | C11H12F4O |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)Cc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4O/c1-10(2,16)6-7-3-8(11(13,14)15)5-9(12)4-7/h3-5,16H,6H2,1-2H3 |
| InChIKey | NLQVNSMFRRWNMU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |