C23H30O6 — CID 70248263
trans-(1R,2R)-1,2-bis[(1R)-1,2-dihydroxy-3-phenylpropyl]-3,3-dimethylcyclopropane-1,2-diol (PubChem CID 70248263) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-bis[(1R)-1,2-dihydroxy-3-phenylpropyl]-3,3-dimethylcyclopropane-1,2-diol.
| Compound Name | trans-(1R,2R)-1,2-bis[(1R)-1,2-dihydroxy-3-phenylpropyl]-3,3-dimethylcyclopropane-1,2-diol |
|---|---|
| PubChem CID | 70248263 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | trans-(1R,2R)-1,2-bis[(1R)-1,2-dihydroxy-3-phenylpropyl]-3,3-dimethylcyclopropane-1,2-diol |
| SMILES | CC1(C)[C@@](O)([C@H](O)C(O)Cc2ccccc2)[C@]1(O)[C@H](O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C23H30O6/c1-21(2)22(28,19(26)17(24)13-15-9-5-3-6-10-15)23(21,29)20(27)18(25)14-16-11-7-4-8-12-16/h3-12,17-20,24-29H,13-14H2,1-2H3/t17?,18?,19-,20-,22+,23+/m1/s1 |
| InChIKey | IRDKCQXJMHWLGS-QEJMXYCJSA-N |
| XLogP | 0.42 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |