C12H14Cl3N — CID 65030216
2-chloro-2-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]ethanamine (PubChem CID 65030216) has the molecular formula C12H14Cl3N and a molecular weight of 278.61 g/mol. Its IUPAC name is 2-chloro-2-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]ethanamine.
| Compound Name | 2-chloro-2-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 65030216 |
| Molecular Formula | C12H14Cl3N |
| Molecular Weight | 278.61 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-chloro-2-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]ethanamine |
| SMILES | Clc1ccc(CNCC(Cl)C2CC2)cc1Cl |
| InChI | InChI=1S/C12H14Cl3N/c13-10-4-1-8(5-11(10)14)6-16-7-12(15)9-2-3-9/h1,4-5,9,12,16H,2-3,6-7H2 |
| InChIKey | QGPNWMPFOBUKMB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|