C13H15Cl2N — CID 104805196
1-(3,4-dichlorophenyl)hept-5-yn-2-amine (PubChem CID 104805196) has the molecular formula C13H15Cl2N and a molecular weight of 256.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)hept-5-yn-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)hept-5-yn-2-amine |
|---|---|
| PubChem CID | 104805196 |
| Molecular Formula | C13H15Cl2N |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)hept-5-yn-2-amine |
| SMILES | CC#CCCC(N)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N/c1-2-3-4-5-11(16)8-10-6-7-12(14)13(15)9-10/h6-7,9,11H,4-5,8,16H2,1H3 |
| InChIKey | AMPZSXWRPSMFTJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|