C15H14BrCl2N — CID 63411923
1-(4-bromophenyl)-3-(3,4-dichlorophenyl)propan-2-amine (PubChem CID 63411923) has the molecular formula C15H14BrCl2N and a molecular weight of 359.09 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(3,4-dichlorophenyl)propan-2-amine.
| Compound Name | 1-(4-bromophenyl)-3-(3,4-dichlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 63411923 |
| Molecular Formula | C15H14BrCl2N |
| Molecular Weight | 359.09 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 1-(4-bromophenyl)-3-(3,4-dichlorophenyl)propan-2-amine |
| SMILES | NC(Cc1ccc(Br)cc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14BrCl2N/c16-12-4-1-10(2-5-12)7-13(19)8-11-3-6-14(17)15(18)9-11/h1-6,9,13H,7-8,19H2 |
| InChIKey | JLQTVPVWGTUARC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.09 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |