C17H29ClN2 — CID 81165942
4-(2-aminobutyl)-2-chloro-N-(2-methylpropyl)-N-propan-2-ylaniline (PubChem CID 81165942) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is 4-(2-aminobutyl)-2-chloro-N-(2-methylpropyl)-N-propan-2-ylaniline.
| Compound Name | 4-(2-aminobutyl)-2-chloro-N-(2-methylpropyl)-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 81165942 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-(2-aminobutyl)-2-chloro-N-(2-methylpropyl)-N-propan-2-ylaniline |
| SMILES | CCC(N)Cc1ccc(N(CC(C)C)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C17H29ClN2/c1-6-15(19)9-14-7-8-17(16(18)10-14)20(13(4)5)11-12(2)3/h7-8,10,12-13,15H,6,9,11,19H2,1-5H3 |
| InChIKey | LBMGVXVMPONQEC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |