C18H31ClN2 — CID 81159811
4-(2-aminopropyl)-2-chloro-N-(2-methylpropyl)-N-pentan-3-ylaniline (PubChem CID 81159811) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is 4-(2-aminopropyl)-2-chloro-N-(2-methylpropyl)-N-pentan-3-ylaniline.
| Compound Name | 4-(2-aminopropyl)-2-chloro-N-(2-methylpropyl)-N-pentan-3-ylaniline |
|---|---|
| PubChem CID | 81159811 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 4-(2-aminopropyl)-2-chloro-N-(2-methylpropyl)-N-pentan-3-ylaniline |
| SMILES | CCC(CC)N(CC(C)C)c1ccc(CC(C)N)cc1Cl |
| InChI | InChI=1S/C18H31ClN2/c1-6-16(7-2)21(12-13(3)4)18-9-8-15(10-14(5)20)11-17(18)19/h8-9,11,13-14,16H,6-7,10,12,20H2,1-5H3 |
| InChIKey | BBQNULGWIDXYIN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |