C17H31N3 — CID 80634906
5-(2-aminopropyl)-N-(2-methylpropyl)-N-pentan-3-ylpyridin-2-amine (PubChem CID 80634906) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 5-(2-aminopropyl)-N-(2-methylpropyl)-N-pentan-3-ylpyridin-2-amine.
| Compound Name | 5-(2-aminopropyl)-N-(2-methylpropyl)-N-pentan-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 80634906 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 5-(2-aminopropyl)-N-(2-methylpropyl)-N-pentan-3-ylpyridin-2-amine |
| SMILES | CCC(CC)N(CC(C)C)c1ccc(CC(C)N)cn1 |
| InChI | InChI=1S/C17H31N3/c1-6-16(7-2)20(12-13(3)4)17-9-8-15(11-19-17)10-14(5)18/h8-9,11,13-14,16H,6-7,10,12,18H2,1-5H3 |
| InChIKey | DYOGZLRMEKOCQZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |