C10H14ClNO3 — CID 170897457
(2R)-2-(aminomethyl)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride (PubChem CID 170897457) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride.
| Compound Name | (2R)-2-(aminomethyl)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 170897457 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2R)-2-(aminomethyl)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride |
| SMILES | Cl.NC[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H13NO3.ClH/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7;/h1-4,8,12H,5-6,11H2,(H,13,14);1H/t8-;/m1./s1 |
| InChIKey | PTLWPCFPGFZIRA-DDWIOCJRSA-N |
| XLogP | 1.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |