C8H11NO3S — CID 130639383
2-amino-3-hydroxy-3-(5-methylthiophen-3-yl)propanoic acid (PubChem CID 130639383) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-amino-3-hydroxy-3-(5-methylthiophen-3-yl)propanoic acid.
| Compound Name | 2-amino-3-hydroxy-3-(5-methylthiophen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 130639383 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-amino-3-hydroxy-3-(5-methylthiophen-3-yl)propanoic acid |
| SMILES | Cc1cc(C(O)C(N)C(=O)O)cs1 |
| InChI | InChI=1S/C8H11NO3S/c1-4-2-5(3-13-4)7(10)6(9)8(11)12/h2-3,6-7,10H,9H2,1H3,(H,11,12) |
| InChIKey | SBVWFKFWFYTLMO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |