C10H14O2S — CID 103456956
1-cyclopropyl-2-(5-methylthiophen-3-yl)ethane-1,2-diol (PubChem CID 103456956) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-cyclopropyl-2-(5-methylthiophen-3-yl)ethane-1,2-diol.
| Compound Name | 1-cyclopropyl-2-(5-methylthiophen-3-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 103456956 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-cyclopropyl-2-(5-methylthiophen-3-yl)ethane-1,2-diol |
| SMILES | Cc1cc(C(O)C(O)C2CC2)cs1 |
| InChI | InChI=1S/C10H14O2S/c1-6-4-8(5-13-6)10(12)9(11)7-2-3-7/h4-5,7,9-12H,2-3H2,1H3 |
| InChIKey | FYOGLPHPKHIPLC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |