C12H20O2S — CID 103459822
3-ethyl-1-(5-methylthiophen-3-yl)pentane-1,2-diol (PubChem CID 103459822) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-ethyl-1-(5-methylthiophen-3-yl)pentane-1,2-diol.
| Compound Name | 3-ethyl-1-(5-methylthiophen-3-yl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103459822 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-ethyl-1-(5-methylthiophen-3-yl)pentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1csc(C)c1 |
| InChI | InChI=1S/C12H20O2S/c1-4-9(5-2)11(13)12(14)10-6-8(3)15-7-10/h6-7,9,11-14H,4-5H2,1-3H3 |
| InChIKey | AAGOLDJARBQASJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |