C7H12N2S — CID 55294445
1-(5-methylthiophen-3-yl)ethane-1,2-diamine (PubChem CID 55294445) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 1-(5-methylthiophen-3-yl)ethane-1,2-diamine.
| Compound Name | 1-(5-methylthiophen-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55294445 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1-(5-methylthiophen-3-yl)ethane-1,2-diamine |
| SMILES | Cc1cc(C(N)CN)cs1 |
| InChI | InChI=1S/C7H12N2S/c1-5-2-6(4-10-5)7(9)3-8/h2,4,7H,3,8-9H2,1H3 |
| InChIKey | JVBVPZBJGPLUTH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |