C16H16ClNO3 — CID 102360411
(2S,3R)-2-amino-3-(4-benzyl-3-chlorophenyl)-3-hydroxypropanoic acid (PubChem CID 102360411) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-(4-benzyl-3-chlorophenyl)-3-hydroxypropanoic acid.
| Compound Name | (2S,3R)-2-amino-3-(4-benzyl-3-chlorophenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 102360411 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (2S,3R)-2-amino-3-(4-benzyl-3-chlorophenyl)-3-hydroxypropanoic acid |
| SMILES | N[C@H](C(=O)O)[C@H](O)c1ccc(Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClNO3/c17-13-9-12(15(19)14(18)16(20)21)7-6-11(13)8-10-4-2-1-3-5-10/h1-7,9,14-15,19H,8,18H2,(H,20,21)/t14-,15+/m0/s1 |
| InChIKey | GFIMESFSWXCRNB-LSDHHAIUSA-N |
| XLogP | 2.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |