C10H12ClNO3 — CID 83893924
2-amino-2-[3-chloro-4-(methoxymethyl)phenyl]acetic acid (PubChem CID 83893924) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-amino-2-[3-chloro-4-(methoxymethyl)phenyl]acetic acid.
| Compound Name | 2-amino-2-[3-chloro-4-(methoxymethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 83893924 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-amino-2-[3-chloro-4-(methoxymethyl)phenyl]acetic acid |
| SMILES | COCc1ccc(C(N)C(=O)O)cc1Cl |
| InChI | InChI=1S/C10H12ClNO3/c1-15-5-7-3-2-6(4-8(7)11)9(12)10(13)14/h2-4,9H,5,12H2,1H3,(H,13,14) |
| InChIKey | JRYMSBROTPGQQK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |