C11H15NO4 — CID 117323071
2-amino-2-[3-methoxy-5-(methoxymethyl)phenyl]acetic acid (PubChem CID 117323071) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-amino-2-[3-methoxy-5-(methoxymethyl)phenyl]acetic acid.
| Compound Name | 2-amino-2-[3-methoxy-5-(methoxymethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 117323071 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-amino-2-[3-methoxy-5-(methoxymethyl)phenyl]acetic acid |
| SMILES | COCc1cc(OC)cc(C(N)C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO4/c1-15-6-7-3-8(10(12)11(13)14)5-9(4-7)16-2/h3-5,10H,6,12H2,1-2H3,(H,13,14) |
| InChIKey | PCLPXHHEJFCBQM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |