C15H14BrF3OS — CID 115786380
1-[2-bromo-5-(trifluoromethyl)phenyl]-2-(5-ethylthiophen-2-yl)ethanol (PubChem CID 115786380) has the molecular formula C15H14BrF3OS and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]-2-(5-ethylthiophen-2-yl)ethanol.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-2-(5-ethylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 115786380 |
| Molecular Formula | C15H14BrF3OS |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-2-(5-ethylthiophen-2-yl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cc(C(F)(F)F)ccc2Br)s1 |
| InChI | InChI=1S/C15H14BrF3OS/c1-2-10-4-5-11(21-10)8-14(20)12-7-9(15(17,18)19)3-6-13(12)16/h3-7,14,20H,2,8H2,1H3 |
| InChIKey | YJTFECYZIAKOGA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |