C14H15Br2NS2 — CID 66056486
1-(4-bromophenyl)sulfanyl-3-(3-bromothiophen-2-yl)-N-methylpropan-2-amine (PubChem CID 66056486) has the molecular formula C14H15Br2NS2 and a molecular weight of 421.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(3-bromothiophen-2-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(3-bromothiophen-2-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66056486 |
| Molecular Formula | C14H15Br2NS2 |
| Molecular Weight | 421.22 g/mol |
| Exact Mass | 418.90 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(3-bromothiophen-2-yl)-N-methylpropan-2-amine |
| SMILES | CNC(CSc1ccc(Br)cc1)Cc1sccc1Br |
| InChI | InChI=1S/C14H15Br2NS2/c1-17-11(8-14-13(16)6-7-18-14)9-19-12-4-2-10(15)3-5-12/h2-7,11,17H,8-9H2,1H3 |
| InChIKey | WBFLYBJVODFRTQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.22 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |