C12H20BrNS — CID 62603747
1-(3-bromothiophen-2-yl)-N,5-dimethylhexan-2-amine (PubChem CID 62603747) has the molecular formula C12H20BrNS and a molecular weight of 290.27 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N,5-dimethylhexan-2-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 62603747 |
| Molecular Formula | C12H20BrNS |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N,5-dimethylhexan-2-amine |
| SMILES | CNC(CCC(C)C)Cc1sccc1Br |
| InChI | InChI=1S/C12H20BrNS/c1-9(2)4-5-10(14-3)8-12-11(13)6-7-15-12/h6-7,9-10,14H,4-5,8H2,1-3H3 |
| InChIKey | LFUDCEZQZSBYCW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |