C15H17BrClNS2 — CID 66144182
1-(4-bromothiophen-2-yl)-3-(4-chlorophenyl)sulfanyl-N-ethylpropan-2-amine (PubChem CID 66144182) has the molecular formula C15H17BrClNS2 and a molecular weight of 390.80 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-3-(4-chlorophenyl)sulfanyl-N-ethylpropan-2-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-3-(4-chlorophenyl)sulfanyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 66144182 |
| Molecular Formula | C15H17BrClNS2 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-3-(4-chlorophenyl)sulfanyl-N-ethylpropan-2-amine |
| SMILES | CCNC(CSc1ccc(Cl)cc1)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C15H17BrClNS2/c1-2-18-13(8-15-7-11(16)9-19-15)10-20-14-5-3-12(17)4-6-14/h3-7,9,13,18H,2,8,10H2,1H3 |
| InChIKey | QANTVYRHVPHJDM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |