C13H16FNS — CID 66073273
N-ethyl-1-(4-fluorophenyl)sulfanylpent-4-yn-2-amine (PubChem CID 66073273) has the molecular formula C13H16FNS and a molecular weight of 237.34 g/mol. Its IUPAC name is N-ethyl-1-(4-fluorophenyl)sulfanylpent-4-yn-2-amine.
| Compound Name | N-ethyl-1-(4-fluorophenyl)sulfanylpent-4-yn-2-amine |
|---|---|
| PubChem CID | 66073273 |
| Molecular Formula | C13H16FNS |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-ethyl-1-(4-fluorophenyl)sulfanylpent-4-yn-2-amine |
| SMILES | C#CCC(CSc1ccc(F)cc1)NCC |
| InChI | InChI=1S/C13H16FNS/c1-3-5-12(15-4-2)10-16-13-8-6-11(14)7-9-13/h1,6-9,12,15H,4-5,10H2,2H3 |
| InChIKey | CHXCQSJAVSRZHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|