C10H16BrNO2S2 — CID 115601848
1-(5-bromothiophen-2-yl)-N-ethyl-3-methylsulfonylpropan-2-amine (PubChem CID 115601848) has the molecular formula C10H16BrNO2S2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-ethyl-3-methylsulfonylpropan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-ethyl-3-methylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 115601848 |
| Molecular Formula | C10H16BrNO2S2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-ethyl-3-methylsulfonylpropan-2-amine |
| SMILES | CCNC(Cc1ccc(Br)s1)CS(C)(=O)=O |
| InChI | InChI=1S/C10H16BrNO2S2/c1-3-12-8(7-16(2,13)14)6-9-4-5-10(11)15-9/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | ZWEKLYXKSVPQSE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |