C12H16BrF2NO2S — CID 106274146
1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3-methylsulfonylpropan-2-amine (PubChem CID 106274146) has the molecular formula C12H16BrF2NO2S and a molecular weight of 356.23 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3-methylsulfonylpropan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3-methylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 106274146 |
| Molecular Formula | C12H16BrF2NO2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3-methylsulfonylpropan-2-amine |
| SMILES | CCNC(Cc1c(F)ccc(Br)c1F)CS(C)(=O)=O |
| InChI | InChI=1S/C12H16BrF2NO2S/c1-3-16-8(7-19(2,17)18)6-9-11(14)5-4-10(13)12(9)15/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | ZDKMKDYELROMQM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|