C16H15BrFNS2 — CID 105139333
2-(4-bromothiophen-2-yl)-N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine (PubChem CID 105139333) has the molecular formula C16H15BrFNS2 and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 105139333 |
| Molecular Formula | C16H15BrFNS2 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-ethyl-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine |
| SMILES | CCNC(Cc1cc(Br)cs1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C16H15BrFNS2/c1-2-19-14(8-13-7-11(17)9-20-13)16-6-10-5-12(18)3-4-15(10)21-16/h3-7,9,14,19H,2,8H2,1H3 |
| InChIKey | ROLOOPKZBMTYSK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |