C15H15FN2S2 — CID 105306761
[1-(6-fluoro-1-benzothiophen-2-yl)-3-thiophen-3-ylpropyl]hydrazine (PubChem CID 105306761) has the molecular formula C15H15FN2S2 and a molecular weight of 306.43 g/mol. Its IUPAC name is [1-(6-fluoro-1-benzothiophen-2-yl)-3-thiophen-3-ylpropyl]hydrazine.
| Compound Name | [1-(6-fluoro-1-benzothiophen-2-yl)-3-thiophen-3-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 105306761 |
| Molecular Formula | C15H15FN2S2 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [1-(6-fluoro-1-benzothiophen-2-yl)-3-thiophen-3-ylpropyl]hydrazine |
| SMILES | NNC(CCc1ccsc1)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C15H15FN2S2/c16-12-3-2-11-7-15(20-14(11)8-12)13(18-17)4-1-10-5-6-19-9-10/h2-3,5-9,13,18H,1,4,17H2 |
| InChIKey | DKHPYUJOXHMRNG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|