C16H14F2N2S — CID 105283753
[1-(6-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine (PubChem CID 105283753) has the molecular formula C16H14F2N2S and a molecular weight of 304.37 g/mol. Its IUPAC name is [1-(6-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(6-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105283753 |
| Molecular Formula | C16H14F2N2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [1-(6-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H14F2N2S/c17-12-4-1-10(2-5-12)7-14(20-19)16-8-11-3-6-13(18)9-15(11)21-16/h1-6,8-9,14,20H,7,19H2 |
| InChIKey | RLYLIEKUFCKOIU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|