C13H17FN2O2S2 — CID 105290885
[1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutyl]hydrazine (PubChem CID 105290885) has the molecular formula C13H17FN2O2S2 and a molecular weight of 316.42 g/mol. Its IUPAC name is [1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutyl]hydrazine.
| Compound Name | [1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutyl]hydrazine |
|---|---|
| PubChem CID | 105290885 |
| Molecular Formula | C13H17FN2O2S2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutyl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(NN)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H17FN2O2S2/c1-20(17,18)6-2-3-11(16-15)13-7-9-4-5-10(14)8-12(9)19-13/h4-5,7-8,11,16H,2-3,6,15H2,1H3 |
| InChIKey | YFSPCECTMPSNJX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|