C14H18FNO2S2 — CID 115820928
1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-4-methylsulfonylbutan-1-amine (PubChem CID 115820928) has the molecular formula C14H18FNO2S2 and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 115820928 |
| Molecular Formula | C14H18FNO2S2 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-4-methylsulfonylbutan-1-amine |
| SMILES | CNC(CCCS(C)(=O)=O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C14H18FNO2S2/c1-16-12(4-3-7-20(2,17)18)14-8-10-5-6-11(15)9-13(10)19-14/h5-6,8-9,12,16H,3-4,7H2,1-2H3 |
| InChIKey | IVSSBACSHSGKEN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |