C13H15FO3S2 — CID 115780125
1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-ol (PubChem CID 115780125) has the molecular formula C13H15FO3S2 and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-ol.
| Compound Name | 1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 115780125 |
| Molecular Formula | C13H15FO3S2 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-(6-fluoro-1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-ol |
| SMILES | CS(=O)(=O)CCCC(O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H15FO3S2/c1-19(16,17)6-2-3-11(15)13-7-9-4-5-10(14)8-12(9)18-13/h4-5,7-8,11,15H,2-3,6H2,1H3 |
| InChIKey | VOVZCEUQFIIJFF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |