C15H13BrFNS2 — CID 81105147
1-(5-bromo-4-methylthiophen-2-yl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine (PubChem CID 81105147) has the molecular formula C15H13BrFNS2 and a molecular weight of 370.31 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81105147 |
| Molecular Formula | C15H13BrFNS2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)c(Br)s1)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C15H13BrFNS2/c1-8-5-12(20-15(8)16)14(18-2)13-6-9-3-4-10(17)7-11(9)19-13/h3-7,14,18H,1-2H3 |
| InChIKey | QMACJWLZMAUSAG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |