C19H27N3S — CID 3844654
4-[1,4-diazepan-1-yl-(3-methylthiophen-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 3844654) has the molecular formula C19H27N3S and a molecular weight of 329.51 g/mol. Its IUPAC name is 4-[1,4-diazepan-1-yl-(3-methylthiophen-2-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[1,4-diazepan-1-yl-(3-methylthiophen-2-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3844654 |
| Molecular Formula | C19H27N3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-[1,4-diazepan-1-yl-(3-methylthiophen-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | Cc1ccsc1C(c1ccc(N(C)C)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C19H27N3S/c1-15-9-14-23-19(15)18(22-12-4-10-20-11-13-22)16-5-7-17(8-6-16)21(2)3/h5-9,14,18,20H,4,10-13H2,1-3H3 |
| InChIKey | DKCSCJFNMDTAHR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|