C21H29N3 — CID 3902289
4-[(4-ethylphenyl)-piperazin-1-ylmethyl]-N,N-dimethylaniline (PubChem CID 3902289) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)-piperazin-1-ylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-ethylphenyl)-piperazin-1-ylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3902289 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 4-[(4-ethylphenyl)-piperazin-1-ylmethyl]-N,N-dimethylaniline |
| SMILES | CCc1ccc(C(c2ccc(N(C)C)cc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C21H29N3/c1-4-17-5-7-18(8-6-17)21(24-15-13-22-14-16-24)19-9-11-20(12-10-19)23(2)3/h5-12,21-22H,4,13-16H2,1-3H3 |
| InChIKey | JYBWQDSZFIWILF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|