C13H17F3N2O2S — CID 171178301
1-[(1R)-2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethyl]piperazine (PubChem CID 171178301) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171178301 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethyl]piperazine |
| SMILES | CS(=O)(=O)c1ccc([C@@H](N2CCNCC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O2S/c1-21(19,20)11-4-2-10(3-5-11)12(13(14,15)16)18-8-6-17-7-9-18/h2-5,12,17H,6-9H2,1H3/t12-/m1/s1 |
| InChIKey | RJWWNWRDZTURCY-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |