C16H27ClF2N2O2Si — CID 171179973
(3R)-2,2-difluoro-3-piperazin-1-yl-3-(4-trimethylsilyloxyphenyl)propan-1-ol;hydrochloride (PubChem CID 171179973) has the molecular formula C16H27ClF2N2O2Si and a molecular weight of 380.94 g/mol. Its IUPAC name is (3R)-2,2-difluoro-3-piperazin-1-yl-3-(4-trimethylsilyloxyphenyl)propan-1-ol;hydrochloride.
| Compound Name | (3R)-2,2-difluoro-3-piperazin-1-yl-3-(4-trimethylsilyloxyphenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171179973 |
| Molecular Formula | C16H27ClF2N2O2Si |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (3R)-2,2-difluoro-3-piperazin-1-yl-3-(4-trimethylsilyloxyphenyl)propan-1-ol;hydrochloride |
| SMILES | C[Si](C)(C)Oc1ccc([C@@H](N2CCNCC2)C(F)(F)CO)cc1.Cl |
| InChI | InChI=1S/C16H26F2N2O2Si.ClH/c1-23(2,3)22-14-6-4-13(5-7-14)15(16(17,18)12-21)20-10-8-19-9-11-20;/h4-7,15,19,21H,8-12H2,1-3H3;1H/t15-;/m1./s1 |
| InChIKey | WZVPGKPDWQFDKG-XFULWGLBSA-N |
| XLogP | 2.90 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|