C22H31Cl2N3 — CID 171287705
N-benzyl-4-[(R)-cyclobutyl(piperazin-1-yl)methyl]aniline;dihydrochloride (PubChem CID 171287705) has the molecular formula C22H31Cl2N3 and a molecular weight of 408.42 g/mol. Its IUPAC name is N-benzyl-4-[(R)-cyclobutyl(piperazin-1-yl)methyl]aniline;dihydrochloride.
| Compound Name | N-benzyl-4-[(R)-cyclobutyl(piperazin-1-yl)methyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171287705 |
| Molecular Formula | C22H31Cl2N3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-benzyl-4-[(R)-cyclobutyl(piperazin-1-yl)methyl]aniline;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CNc2ccc([C@@H](C3CCC3)N3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C22H29N3.2ClH/c1-2-5-18(6-3-1)17-24-21-11-9-20(10-12-21)22(19-7-4-8-19)25-15-13-23-14-16-25;;/h1-3,5-6,9-12,19,22-24H,4,7-8,13-17H2;2*1H/t22-;;/m1../s1 |
| InChIKey | ODVOJEMOYIKVAY-GJICFQLNSA-N |
| XLogP | 4.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |